Type: Toxin
Name: Sodium Laureth Sulfate
RDA: 0
Importance- to Body:
Toxin: Skin, Eyes, Other
Distribution- in Body:
Skin
Excess Effects:
Skin Irritation, Organ Toxicity, Skin reactions, Allergic Reactions
Deficiency Effects:
None Listed
Food Sources:
None Listed
Environmental/Geographic Sources:
Body Wash, Shampoo, Soap, Detergents, Toothpaste
Supplemental information:
The “foaming agent” in cleansing products, Detergent and Surfactant (helps create lather), Considered Acutely Toxic, similar to sodium lauryl sulfate
| Names | |
|---|---|
| IUPAC name
α-Sulfo-ω-(dodecyloxy)-poly(oxyethane-1,2-diyl), sodium salt
| |
| Other names
Sodium lauryl ether sulfate
Sodium laureth sulphate Sodium lauryl ether sulphate | |
| Identifiers | |
| Abbreviations | SLES |
| ChemSpider |
|
| ECHA InfoCard | 100.036.281 |
PubChem CID
|
|
| UNII |
|
| Properties | |
| CH3(CH2)11(OCH2CH2)nOSO3Na | |
| Molar mass | Variable; typically around 420 g/mol (288.38 + 44.05n) g/mol |
| Hazards | |
| NFPA 704 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
| Infobox references | |
Sodium laureth sulfate (SLES), an accepted contraction of sodium lauryl ether sulfate (SLES), is an anionic detergent and surfactant found in many personal care products (soaps, shampoos, toothpaste etc.). SLES is an inexpensive and very effective foaming agent. SLES, sodium lauryl sulfate (SLS), ammonium lauryl sulfate (ALS), and sodium pareth sulfate are surfactants that are used in many cosmetic products for their cleaning and emulsifying properties. They behave similarly to soap.
Its chemical formula is CH3(CH2)11(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. It is common for commercial products for n= 3.
